C17H20N2O4S2 — CID 119106879
N-[[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methyl]-2-methylsulfonylethanamine (PubChem CID 119106879) has the molecular formula C17H20N2O4S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-[[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methyl]-2-methylsulfonylethanamine.
| Compound Name | N-[[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methyl]-2-methylsulfonylethanamine |
|---|---|
| PubChem CID | 119106879 |
| Molecular Formula | C17H20N2O4S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | N-[[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methyl]-2-methylsulfonylethanamine |
| SMILES | Cc1ccc(Sc2ccc(CNCCS(C)(=O)=O)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H20N2O4S2/c1-13-3-6-15(7-4-13)24-17-8-5-14(11-16(17)19(20)21)12-18-9-10-25(2,22)23/h3-8,11,18H,9-10,12H2,1-2H3 |
| InChIKey | YUBZZWRHYPKLGU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|