C13H8Cl2N2S2 — CID 106891279
4-(1,3-benzothiazol-2-ylsulfanyl)-3,5-dichloroaniline (PubChem CID 106891279) has the molecular formula C13H8Cl2N2S2 and a molecular weight of 327.26 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanyl)-3,5-dichloroaniline.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-3,5-dichloroaniline |
|---|---|
| PubChem CID | 106891279 |
| Molecular Formula | C13H8Cl2N2S2 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 325.95 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-3,5-dichloroaniline |
| SMILES | Nc1cc(Cl)c(Sc2nc3ccccc3s2)c(Cl)c1 |
| InChI | InChI=1S/C13H8Cl2N2S2/c14-8-5-7(16)6-9(15)12(8)19-13-17-10-3-1-2-4-11(10)18-13/h1-6H,16H2 |
| InChIKey | AJKCUNCERIPLBQ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|