C12H8BrFN6S — CID 107537088
2-bromo-3-fluoro-4-(7H-purin-6-ylsulfanyl)benzenecarboximidamide (PubChem CID 107537088) has the molecular formula C12H8BrFN6S and a molecular weight of 367.21 g/mol. Its IUPAC name is 2-bromo-3-fluoro-4-(7H-purin-6-ylsulfanyl)benzenecarboximidamide.
| Compound Name | 2-bromo-3-fluoro-4-(7H-purin-6-ylsulfanyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 107537088 |
| Molecular Formula | C12H8BrFN6S |
| Molecular Weight | 367.21 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | 2-bromo-3-fluoro-4-(7H-purin-6-ylsulfanyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Sc2ncnc3nc[nH]c23)c(F)c1Br |
| InChI | InChI=1S/C12H8BrFN6S/c13-7-5(10(15)16)1-2-6(8(7)14)21-12-9-11(18-3-17-9)19-4-20-12/h1-4H,(H3,15,16)(H,17,18,19,20) |
| InChIKey | BPGJSHUOKOEWPP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 104.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.21 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|