C11H16N6 — CID 167844435
N-[(3S)-azepan-3-yl]-7H-purin-6-amine (PubChem CID 167844435) has the molecular formula C11H16N6 and a molecular weight of 232.29 g/mol. Its IUPAC name is N-[(3S)-azepan-3-yl]-7H-purin-6-amine.
| Compound Name | N-[(3S)-azepan-3-yl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 167844435 |
| Molecular Formula | C11H16N6 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | N-[(3S)-azepan-3-yl]-7H-purin-6-amine |
| SMILES | c1nc(N[C@H]2CCCCNC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C11H16N6/c1-2-4-12-5-8(3-1)17-11-9-10(14-6-13-9)15-7-16-11/h6-8,12H,1-5H2,(H2,13,14,15,16,17)/t8-/m0/s1 |
| InChIKey | XMQFKJFMXIQUGI-QMMMGPOBSA-N |
| XLogP | 0.91 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |