C19H24N6O2 — CID 67147383
2-ethoxy-4-[[4-(7H-purin-6-ylamino)piperidin-1-yl]methyl]phenol (PubChem CID 67147383) has the molecular formula C19H24N6O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 2-ethoxy-4-[[4-(7H-purin-6-ylamino)piperidin-1-yl]methyl]phenol.
| Compound Name | 2-ethoxy-4-[[4-(7H-purin-6-ylamino)piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 67147383 |
| Molecular Formula | C19H24N6O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 2-ethoxy-4-[[4-(7H-purin-6-ylamino)piperidin-1-yl]methyl]phenol |
| SMILES | CCOc1cc(CN2CCC(Nc3ncnc4nc[nH]c34)CC2)ccc1O |
| InChI | InChI=1S/C19H24N6O2/c1-2-27-16-9-13(3-4-15(16)26)10-25-7-5-14(6-8-25)24-19-17-18(21-11-20-17)22-12-23-19/h3-4,9,11-12,14,26H,2,5-8,10H2,1H3,(H2,20,21,22,23,24) |
| InChIKey | IZOHMTGETROMDR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 99.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |