C21H16ClFN6 — CID 88540381
5-chloro-2-(3-fluorophenyl)-6-methyl-3-[2-(7H-purin-6-ylamino)ethyl]benzonitrile (PubChem CID 88540381) has the molecular formula C21H16ClFN6 and a molecular weight of 406.85 g/mol. Its IUPAC name is 5-chloro-2-(3-fluorophenyl)-6-methyl-3-[2-(7H-purin-6-ylamino)ethyl]benzonitrile.
| Compound Name | 5-chloro-2-(3-fluorophenyl)-6-methyl-3-[2-(7H-purin-6-ylamino)ethyl]benzonitrile |
|---|---|
| PubChem CID | 88540381 |
| Molecular Formula | C21H16ClFN6 |
| Molecular Weight | 406.85 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 5-chloro-2-(3-fluorophenyl)-6-methyl-3-[2-(7H-purin-6-ylamino)ethyl]benzonitrile |
| SMILES | Cc1c(Cl)cc(CCNc2ncnc3nc[nH]c23)c(-c2cccc(F)c2)c1C#N |
| InChI | InChI=1S/C21H16ClFN6/c1-12-16(9-24)18(13-3-2-4-15(23)7-13)14(8-17(12)22)5-6-25-20-19-21(27-10-26-19)29-11-28-20/h2-4,7-8,10-11H,5-6H2,1H3,(H2,25,26,27,28,29) |
| InChIKey | ZCCXRNCUIXDKSG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.85 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |