About 3-(3-fluorophenyl)-2-[(1S)-1-(7H-purin-6-ylamino)propyl]chromen-4-one;hydrobromide
3-(3-fluorophenyl)-2-[(1S)-1-(7H-purin-6-ylamino)propyl]chromen-4-one;hydrobromide (PubChem CID 168966366) has the molecular formula C23H19BrFN5O2
and a molecular weight of 496.34 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-2-[(1S)-1-(7H-purin-6-ylamino)propyl]chromen-4-one;hydrobromide.
Molecular Properties
| Compound Name | 3-(3-fluorophenyl)-2-[(1S)-1-(7H-purin-6-ylamino)propyl]chromen-4-one;hydrobromide |
| PubChem CID | 168966366 |
| Molecular Formula | C23H19BrFN5O2 |
| Molecular Weight | 496.34 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | 3-(3-fluorophenyl)-2-[(1S)-1-(7H-purin-6-ylamino)propyl]chromen-4-one;hydrobromide |
| SMILES | Br.CC[C@H](Nc1ncnc2nc[nH]c12)c1oc2ccccc2c(=O)c1-c1cccc(F)c1 |
| InChI | InChI=1S/C23H18FN5O2.BrH/c1-2-16(29-23-19-22(26-11-25-19)27-12-28-23)21-18(13-6-5-7-14(24)10-13)20(30)15-8-3-4-9-17(15)31-21;/h3-12,16H,2H2,1H3,(H2,25,26,27,28,29);1H/t16-;/m0./s1 |
| InChIKey | UTGRZAKIQRRILX-NTISSMGPSA-N |
| XLogP | 5.41 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.34 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(3-fluorophenyl)-2-[(1S)-1-(7H-purin-6-ylamino)propyl]chromen-4-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-fluorophenyl)-2-[(1S)-1-(7H-purin-6-ylamino)propyl]chromen-4-one;hydrobromide?
The IUPAC name of 3-(3-fluorophenyl)-2-[(1S)-1-(7H-purin-6-ylamino)propyl]chromen-4-one;hydrobromide (CID 168966366) is 3-(3-fluorophenyl)-2-[(1S)-1-(7H-purin-6-ylamino)propyl]chromen-4-one;hydrobromide.
What is the SMILES notation for 3-(3-fluorophenyl)-2-[(1S)-1-(7H-purin-6-ylamino)propyl]chromen-4-one;hydrobromide?
The canonical SMILES for 3-(3-fluorophenyl)-2-[(1S)-1-(7H-purin-6-ylamino)propyl]chromen-4-one;hydrobromide is Br.CC[C@H](Nc1ncnc2nc[nH]c12)c1oc2ccccc2c(=O)c1-c1cccc(F)c1.
What is the InChIKey of 3-(3-fluorophenyl)-2-[(1S)-1-(7H-purin-6-ylamino)propyl]chromen-4-one;hydrobromide?
The InChIKey is UTGRZAKIQRRILX-NTISSMGPSA-N. The full InChI is InChI=1S/C23H18FN5O2.BrH/c1-2-16(29-23-19-22(26-11-25-19)27-12-28-23)21-18(13-6-5-7-14(24)10-13)20(30)15-8-3-4-9-17(15)31-21;/h3-12,16H,2H2,1H3,(H2,25,26,27,28,29);1H/t16-;/m0./s1.
What are the key properties of 3-(3-fluorophenyl)-2-[(1S)-1-(7H-purin-6-ylamino)propyl]chromen-4-one;hydrobromide?
3-(3-fluorophenyl)-2-[(1S)-1-(7H-purin-6-ylamino)propyl]chromen-4-one;hydrobromide has a molecular weight of 496.34 g/mol, XLogP of 5.41, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-fluorophenyl)-2-[(1S)-1-(7H-purin-6-ylamino)propyl]chromen-4-one;hydrobromide is sourced from PubChem (CID 168966366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).