C23H18FN5O2 — CID 89154248
5-fluoro-3-(2-methylphenyl)-2-[1-(7H-purin-6-ylamino)ethyl]chromen-4-one (PubChem CID 89154248) has the molecular formula C23H18FN5O2 and a molecular weight of 415.43 g/mol. Its IUPAC name is 5-fluoro-3-(2-methylphenyl)-2-[1-(7H-purin-6-ylamino)ethyl]chromen-4-one.
| Compound Name | 5-fluoro-3-(2-methylphenyl)-2-[1-(7H-purin-6-ylamino)ethyl]chromen-4-one |
|---|---|
| PubChem CID | 89154248 |
| Molecular Formula | C23H18FN5O2 |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 5-fluoro-3-(2-methylphenyl)-2-[1-(7H-purin-6-ylamino)ethyl]chromen-4-one |
| SMILES | Cc1ccccc1-c1c(C(C)Nc2ncnc3nc[nH]c23)oc2cccc(F)c2c1=O |
| InChI | InChI=1S/C23H18FN5O2/c1-12-6-3-4-7-14(12)17-20(30)18-15(24)8-5-9-16(18)31-21(17)13(2)29-23-19-22(26-10-25-19)27-11-28-23/h3-11,13H,1-2H3,(H2,25,26,27,28,29) |
| InChIKey | LNGVNKJTCAEJKZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |