C24H21FN6O — CID 144835336
7-fluoro-2-(2-methylphenyl)-3-[(1S)-1-(7H-purin-6-ylamino)propyl]isoquinolin-1-one (PubChem CID 144835336) has the molecular formula C24H21FN6O and a molecular weight of 428.47 g/mol. Its IUPAC name is 7-fluoro-2-(2-methylphenyl)-3-[(1S)-1-(7H-purin-6-ylamino)propyl]isoquinolin-1-one.
| Compound Name | 7-fluoro-2-(2-methylphenyl)-3-[(1S)-1-(7H-purin-6-ylamino)propyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 144835336 |
| Molecular Formula | C24H21FN6O |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 7-fluoro-2-(2-methylphenyl)-3-[(1S)-1-(7H-purin-6-ylamino)propyl]isoquinolin-1-one |
| SMILES | CC[C@H](Nc1ncnc2nc[nH]c12)c1cc2ccc(F)cc2c(=O)n1-c1ccccc1C |
| InChI | InChI=1S/C24H21FN6O/c1-3-18(30-23-21-22(27-12-26-21)28-13-29-23)20-10-15-8-9-16(25)11-17(15)24(32)31(20)19-7-5-4-6-14(19)2/h4-13,18H,3H2,1-2H3,(H2,26,27,28,29,30)/t18-/m0/s1 |
| InChIKey | MHLZRRNKJZEFPU-SFHVURJKSA-N |
| XLogP | 4.67 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |