C24H22FN7O — CID 118044033
3-[1-[(2-amino-7H-purin-6-yl)amino]propyl]-7-fluoro-2-(2-methylphenyl)isoquinolin-1-one (PubChem CID 118044033) has the molecular formula C24H22FN7O and a molecular weight of 443.49 g/mol. Its IUPAC name is 3-[1-[(2-amino-7H-purin-6-yl)amino]propyl]-7-fluoro-2-(2-methylphenyl)isoquinolin-1-one.
| Compound Name | 3-[1-[(2-amino-7H-purin-6-yl)amino]propyl]-7-fluoro-2-(2-methylphenyl)isoquinolin-1-one |
|---|---|
| PubChem CID | 118044033 |
| Molecular Formula | C24H22FN7O |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 3-[1-[(2-amino-7H-purin-6-yl)amino]propyl]-7-fluoro-2-(2-methylphenyl)isoquinolin-1-one |
| SMILES | CCC(Nc1nc(N)nc2nc[nH]c12)c1cc2ccc(F)cc2c(=O)n1-c1ccccc1C |
| InChI | InChI=1S/C24H22FN7O/c1-3-17(29-22-20-21(28-12-27-20)30-24(26)31-22)19-10-14-8-9-15(25)11-16(14)23(33)32(19)18-7-5-4-6-13(18)2/h4-12,17H,3H2,1-2H3,(H4,26,27,28,29,30,31) |
| InChIKey | KBENEGBKUUVKGG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |