C21H23FN6 — CID 66632120
N-[(1S)-1-[7-fluoro-2-(2-methylbutyl)quinolin-3-yl]ethyl]-7H-purin-6-amine (PubChem CID 66632120) has the molecular formula C21H23FN6 and a molecular weight of 378.46 g/mol. Its IUPAC name is N-[(1S)-1-[7-fluoro-2-(2-methylbutyl)quinolin-3-yl]ethyl]-7H-purin-6-amine.
| Compound Name | N-[(1S)-1-[7-fluoro-2-(2-methylbutyl)quinolin-3-yl]ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 66632120 |
| Molecular Formula | C21H23FN6 |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | N-[(1S)-1-[7-fluoro-2-(2-methylbutyl)quinolin-3-yl]ethyl]-7H-purin-6-amine |
| SMILES | CCC(C)Cc1nc2cc(F)ccc2cc1[C@H](C)Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C21H23FN6/c1-4-12(2)7-18-16(8-14-5-6-15(22)9-17(14)28-18)13(3)27-21-19-20(24-10-23-19)25-11-26-21/h5-6,8-13H,4,7H2,1-3H3,(H2,23,24,25,26,27)/t12?,13-/m0/s1 |
| InChIKey | GKSDBDFMRANVTQ-ABLWVSNPSA-N |
| XLogP | 4.80 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |