C12H18N4S — CID 19689093
6-heptyl-1,7-dihydropurine-2-thione (PubChem CID 19689093) has the molecular formula C12H18N4S and a molecular weight of 250.37 g/mol. Its IUPAC name is 6-heptyl-1,7-dihydropurine-2-thione.
| Compound Name | 6-heptyl-1,7-dihydropurine-2-thione |
|---|---|
| PubChem CID | 19689093 |
| Molecular Formula | C12H18N4S |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 6-heptyl-1,7-dihydropurine-2-thione |
| SMILES | CCCCCCCc1[nH]c(=S)nc2nc[nH]c12 |
| InChI | InChI=1S/C12H18N4S/c1-2-3-4-5-6-7-9-10-11(14-8-13-10)16-12(17)15-9/h8H,2-7H2,1H3,(H2,13,14,15,16,17) |
| InChIKey | KHGYQXLRZDQLAA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|