C23H31N7O3 — CID 118515637
N-hydroxy-7-[4-[(6-piperidin-1-yl-7H-purin-2-yl)amino]phenoxy]heptanamide (PubChem CID 118515637) has the molecular formula C23H31N7O3 and a molecular weight of 453.55 g/mol. Its IUPAC name is N-hydroxy-7-[4-[(6-piperidin-1-yl-7H-purin-2-yl)amino]phenoxy]heptanamide.
| Compound Name | N-hydroxy-7-[4-[(6-piperidin-1-yl-7H-purin-2-yl)amino]phenoxy]heptanamide |
|---|---|
| PubChem CID | 118515637 |
| Molecular Formula | C23H31N7O3 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | N-hydroxy-7-[4-[(6-piperidin-1-yl-7H-purin-2-yl)amino]phenoxy]heptanamide |
| SMILES | O=C(CCCCCCOc1ccc(Nc2nc(N3CCCCC3)c3[nH]cnc3n2)cc1)NO |
| InChI | InChI=1S/C23H31N7O3/c31-19(29-32)8-4-1-2-7-15-33-18-11-9-17(10-12-18)26-23-27-21-20(24-16-25-21)22(28-23)30-13-5-3-6-14-30/h9-12,16,32H,1-8,13-15H2,(H,29,31)(H2,24,25,26,27,28) |
| InChIKey | QZCIXFFRUDGFKU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 128.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|