C30H37N7O3 — CID 144937307
6-N-benzyl-2-N-[4-(3-methoxypropoxy)phenyl]-7H-purine-2,6-diamine;1-piperidin-1-ylprop-2-en-1-one (PubChem CID 144937307) has the molecular formula C30H37N7O3 and a molecular weight of 543.67 g/mol. Its IUPAC name is 6-N-benzyl-2-N-[4-(3-methoxypropoxy)phenyl]-7H-purine-2,6-diamine;1-piperidin-1-ylprop-2-en-1-one.
| Compound Name | 6-N-benzyl-2-N-[4-(3-methoxypropoxy)phenyl]-7H-purine-2,6-diamine;1-piperidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 144937307 |
| Molecular Formula | C30H37N7O3 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.30 |
| IUPAC Name | 6-N-benzyl-2-N-[4-(3-methoxypropoxy)phenyl]-7H-purine-2,6-diamine;1-piperidin-1-ylprop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCCC1.COCCCOc1ccc(Nc2nc(NCc3ccccc3)c3[nH]cnc3n2)cc1 |
| InChI | InChI=1S/C22H24N6O2.C8H13NO/c1-29-12-5-13-30-18-10-8-17(9-11-18)26-22-27-20(19-21(28-22)25-15-24-19)23-14-16-6-3-2-4-7-16;1-2-8(10)9-6-4-3-5-7-9/h2-4,6-11,15H,5,12-14H2,1H3,(H3,23,24,25,26,27,28);2H,1,3-7H2 |
| InChIKey | FUAHEFKHUQKBSI-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 117.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|