C21H20N6O3 — CID 117079140
2-N-(1,3-benzodioxol-5-ylmethyl)-6-N-(2-phenoxyethyl)-7H-purine-2,6-diamine (PubChem CID 117079140) has the molecular formula C21H20N6O3 and a molecular weight of 404.43 g/mol. Its IUPAC name is 2-N-(1,3-benzodioxol-5-ylmethyl)-6-N-(2-phenoxyethyl)-7H-purine-2,6-diamine.
| Compound Name | 2-N-(1,3-benzodioxol-5-ylmethyl)-6-N-(2-phenoxyethyl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 117079140 |
| Molecular Formula | C21H20N6O3 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 2-N-(1,3-benzodioxol-5-ylmethyl)-6-N-(2-phenoxyethyl)-7H-purine-2,6-diamine |
| SMILES | c1ccc(OCCNc2nc(NCc3ccc4c(c3)OCO4)nc3nc[nH]c23)cc1 |
| InChI | InChI=1S/C21H20N6O3/c1-2-4-15(5-3-1)28-9-8-22-19-18-20(25-12-24-18)27-21(26-19)23-11-14-6-7-16-17(10-14)30-13-29-16/h1-7,10,12H,8-9,11,13H2,(H3,22,23,24,25,26,27) |
| InChIKey | DHZGCORPPLLBSE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 106.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|