C16H17F3N6O — CID 155517706
6-N-(2-methoxyethyl)-2-N-[[3-(trifluoromethyl)phenyl]methyl]-7H-purine-2,6-diamine (PubChem CID 155517706) has the molecular formula C16H17F3N6O and a molecular weight of 366.35 g/mol. Its IUPAC name is 6-N-(2-methoxyethyl)-2-N-[[3-(trifluoromethyl)phenyl]methyl]-7H-purine-2,6-diamine.
| Compound Name | 6-N-(2-methoxyethyl)-2-N-[[3-(trifluoromethyl)phenyl]methyl]-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 155517706 |
| Molecular Formula | C16H17F3N6O |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 6-N-(2-methoxyethyl)-2-N-[[3-(trifluoromethyl)phenyl]methyl]-7H-purine-2,6-diamine |
| SMILES | COCCNc1nc(NCc2cccc(C(F)(F)F)c2)nc2nc[nH]c12 |
| InChI | InChI=1S/C16H17F3N6O/c1-26-6-5-20-13-12-14(23-9-22-12)25-15(24-13)21-8-10-3-2-4-11(7-10)16(17,18)19/h2-4,7,9H,5-6,8H2,1H3,(H3,20,21,22,23,24,25) |
| InChIKey | XQARGJAPYGWPPS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 87.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|