C19H15F3N6O — CID 117084170
2-(6-methoxy-3-pyridinyl)-N-[[3-(trifluoromethyl)phenyl]methyl]-7H-purin-6-amine (PubChem CID 117084170) has the molecular formula C19H15F3N6O and a molecular weight of 400.36 g/mol. Its IUPAC name is 2-(6-methoxy-3-pyridinyl)-N-[[3-(trifluoromethyl)phenyl]methyl]-7H-purin-6-amine.
| Compound Name | 2-(6-methoxy-3-pyridinyl)-N-[[3-(trifluoromethyl)phenyl]methyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 117084170 |
| Molecular Formula | C19H15F3N6O |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 2-(6-methoxy-3-pyridinyl)-N-[[3-(trifluoromethyl)phenyl]methyl]-7H-purin-6-amine |
| SMILES | COc1ccc(-c2nc(NCc3cccc(C(F)(F)F)c3)c3[nH]cnc3n2)cn1 |
| InChI | InChI=1S/C19H15F3N6O/c1-29-14-6-5-12(9-23-14)16-27-17(15-18(28-16)26-10-25-15)24-8-11-3-2-4-13(7-11)19(20,21)22/h2-7,9-10H,8H2,1H3,(H2,24,25,26,27,28) |
| InChIKey | DFBWLRTYOZXCKW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |