C21H16F3N5O — CID 117082638
1-[3-[6-[[3-(trifluoromethyl)phenyl]methylamino]-7H-purin-2-yl]phenyl]ethanone (PubChem CID 117082638) has the molecular formula C21H16F3N5O and a molecular weight of 411.39 g/mol. Its IUPAC name is 1-[3-[6-[[3-(trifluoromethyl)phenyl]methylamino]-7H-purin-2-yl]phenyl]ethanone.
| Compound Name | 1-[3-[6-[[3-(trifluoromethyl)phenyl]methylamino]-7H-purin-2-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 117082638 |
| Molecular Formula | C21H16F3N5O |
| Molecular Weight | 411.39 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 1-[3-[6-[[3-(trifluoromethyl)phenyl]methylamino]-7H-purin-2-yl]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(-c2nc(NCc3cccc(C(F)(F)F)c3)c3[nH]cnc3n2)c1 |
| InChI | InChI=1S/C21H16F3N5O/c1-12(30)14-5-3-6-15(9-14)18-28-19(17-20(29-18)27-11-26-17)25-10-13-4-2-7-16(8-13)21(22,23)24/h2-9,11H,10H2,1H3,(H2,25,26,27,28,29) |
| InChIKey | TTWQKAPWBCIYGS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.39 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |