C19H16N6O — CID 155563377
N-[6-(benzylamino)-7H-purin-2-yl]benzamide (PubChem CID 155563377) has the molecular formula C19H16N6O and a molecular weight of 344.38 g/mol. Its IUPAC name is N-[6-(benzylamino)-7H-purin-2-yl]benzamide.
| Compound Name | N-[6-(benzylamino)-7H-purin-2-yl]benzamide |
|---|---|
| PubChem CID | 155563377 |
| Molecular Formula | C19H16N6O |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | N-[6-(benzylamino)-7H-purin-2-yl]benzamide |
| SMILES | O=C(Nc1nc(NCc2ccccc2)c2[nH]cnc2n1)c1ccccc1 |
| InChI | InChI=1S/C19H16N6O/c26-18(14-9-5-2-6-10-14)25-19-23-16(15-17(24-19)22-12-21-15)20-11-13-7-3-1-4-8-13/h1-10,12H,11H2,(H3,20,21,22,23,24,25,26) |
| InChIKey | NXAHYBYFRVVHRF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |