C20H18N6O2 — CID 117084912
2-N-(1,3-benzodioxol-5-ylmethyl)-6-N-benzyl-7H-purine-2,6-diamine (PubChem CID 117084912) has the molecular formula C20H18N6O2 and a molecular weight of 374.40 g/mol. Its IUPAC name is 2-N-(1,3-benzodioxol-5-ylmethyl)-6-N-benzyl-7H-purine-2,6-diamine.
| Compound Name | 2-N-(1,3-benzodioxol-5-ylmethyl)-6-N-benzyl-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 117084912 |
| Molecular Formula | C20H18N6O2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2-N-(1,3-benzodioxol-5-ylmethyl)-6-N-benzyl-7H-purine-2,6-diamine |
| SMILES | c1ccc(CNc2nc(NCc3ccc4c(c3)OCO4)nc3nc[nH]c23)cc1 |
| InChI | InChI=1S/C20H18N6O2/c1-2-4-13(5-3-1)9-21-18-17-19(24-11-23-17)26-20(25-18)22-10-14-6-7-15-16(8-14)28-12-27-15/h1-8,11H,9-10,12H2,(H3,21,22,23,24,25,26) |
| InChIKey | LEFYNEKRLOCSOW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 96.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |