C53H60N10O5 — CID 160635598
8-[4-[(6-benzyl-7H-purin-2-yl)amino]phenoxy]-1-hydroxyoctan-2-one;9-[4-[(6-benzyl-7H-purin-2-yl)amino]phenoxy]nonan-3-one (PubChem CID 160635598) has the molecular formula C53H60N10O5 and a molecular weight of 917.13 g/mol. Its IUPAC name is 8-[4-[(6-benzyl-7H-purin-2-yl)amino]phenoxy]-1-hydroxyoctan-2-one;9-[4-[(6-benzyl-7H-purin-2-yl)amino]phenoxy]nonan-3-one.
| Compound Name | 8-[4-[(6-benzyl-7H-purin-2-yl)amino]phenoxy]-1-hydroxyoctan-2-one;9-[4-[(6-benzyl-7H-purin-2-yl)amino]phenoxy]nonan-3-one |
|---|---|
| PubChem CID | 160635598 |
| Molecular Formula | C53H60N10O5 |
| Molecular Weight | 917.13 g/mol |
| Exact Mass | 916.47 |
| IUPAC Name | 8-[4-[(6-benzyl-7H-purin-2-yl)amino]phenoxy]-1-hydroxyoctan-2-one;9-[4-[(6-benzyl-7H-purin-2-yl)amino]phenoxy]nonan-3-one |
| SMILES | CCC(=O)CCCCCCOc1ccc(Nc2nc(Cc3ccccc3)c3[nH]cnc3n2)cc1.O=C(CO)CCCCCCOc1ccc(Nc2nc(Cc3ccccc3)c3[nH]cnc3n2)cc1 |
| InChI | InChI=1S/C27H31N5O2.C26H29N5O3/c1-2-22(33)12-8-3-4-9-17-34-23-15-13-21(14-16-23)30-27-31-24(18-20-10-6-5-7-11-20)25-26(32-27)29-19-28-25;32-17-21(33)10-6-1-2-7-15-34-22-13-11-20(12-14-22)29-26-30-23(16-19-8-4-3-5-9-19)24-25(31-26)28-18-27-24/h5-7,10-11,13-16,19H,2-4,8-9,12,17-18H2,1H3,(H2,28,29,30,31,32);3-5,8-9,11-14,18,32H,1-2,6-7,10,15-17H2,(H2,27,28,29,30,31) |
| InChIKey | RIMPXSJQBYPKEW-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 205.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.13 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|