C24H35N7O3 — CID 118518101
N-hydroxy-8-[4-[[6-(pentan-2-ylamino)-7H-purin-2-yl]amino]phenoxy]octanamide (PubChem CID 118518101) has the molecular formula C24H35N7O3 and a molecular weight of 469.59 g/mol. Its IUPAC name is N-hydroxy-8-[4-[[6-(pentan-2-ylamino)-7H-purin-2-yl]amino]phenoxy]octanamide.
| Compound Name | N-hydroxy-8-[4-[[6-(pentan-2-ylamino)-7H-purin-2-yl]amino]phenoxy]octanamide |
|---|---|
| PubChem CID | 118518101 |
| Molecular Formula | C24H35N7O3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | N-hydroxy-8-[4-[[6-(pentan-2-ylamino)-7H-purin-2-yl]amino]phenoxy]octanamide |
| SMILES | CCCC(C)Nc1nc(Nc2ccc(OCCCCCCCC(=O)NO)cc2)nc2nc[nH]c12 |
| InChI | InChI=1S/C24H35N7O3/c1-3-9-17(2)27-23-21-22(26-16-25-21)29-24(30-23)28-18-11-13-19(14-12-18)34-15-8-6-4-5-7-10-20(32)31-33/h11-14,16-17,33H,3-10,15H2,1-2H3,(H,31,32)(H3,25,26,27,28,29,30) |
| InChIKey | JBVRVIKOOWLHCS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 137.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|