C25H36ClN7O3 — CID 175058647
8-[4-[[6-(cyclohexylamino)-7H-purin-2-yl]amino]phenoxy]-8-hydroxyoctanamide;hydrochloride (PubChem CID 175058647) has the molecular formula C25H36ClN7O3 and a molecular weight of 518.06 g/mol. Its IUPAC name is 8-[4-[[6-(cyclohexylamino)-7H-purin-2-yl]amino]phenoxy]-8-hydroxyoctanamide;hydrochloride.
| Compound Name | 8-[4-[[6-(cyclohexylamino)-7H-purin-2-yl]amino]phenoxy]-8-hydroxyoctanamide;hydrochloride |
|---|---|
| PubChem CID | 175058647 |
| Molecular Formula | C25H36ClN7O3 |
| Molecular Weight | 518.06 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | 8-[4-[[6-(cyclohexylamino)-7H-purin-2-yl]amino]phenoxy]-8-hydroxyoctanamide;hydrochloride |
| SMILES | Cl.NC(=O)CCCCCCC(O)Oc1ccc(Nc2nc(NC3CCCCC3)c3[nH]cnc3n2)cc1 |
| InChI | InChI=1S/C25H35N7O3.ClH/c26-20(33)10-6-1-2-7-11-21(34)35-19-14-12-18(13-15-19)30-25-31-23-22(27-16-28-23)24(32-25)29-17-8-4-3-5-9-17;/h12-17,21,34H,1-11H2,(H2,26,33)(H3,27,28,29,30,31,32);1H |
| InChIKey | MRVMBYLGTDZOIB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 151.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.06 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|