C30H41N5O4 — CID 126706183
methyl 7-[4-[[6-cyclohexyl-9-(oxan-2-yl)purin-2-yl]amino]phenoxy]heptanoate (PubChem CID 126706183) has the molecular formula C30H41N5O4 and a molecular weight of 535.69 g/mol. Its IUPAC name is methyl 7-[4-[[6-cyclohexyl-9-(oxan-2-yl)purin-2-yl]amino]phenoxy]heptanoate.
| Compound Name | methyl 7-[4-[[6-cyclohexyl-9-(oxan-2-yl)purin-2-yl]amino]phenoxy]heptanoate |
|---|---|
| PubChem CID | 126706183 |
| Molecular Formula | C30H41N5O4 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.32 |
| IUPAC Name | methyl 7-[4-[[6-cyclohexyl-9-(oxan-2-yl)purin-2-yl]amino]phenoxy]heptanoate |
| SMILES | COC(=O)CCCCCCOc1ccc(Nc2nc(C3CCCCC3)c3ncn(C4CCCCO4)c3n2)cc1 |
| InChI | InChI=1S/C30H41N5O4/c1-37-26(36)14-7-2-3-9-19-38-24-17-15-23(16-18-24)32-30-33-27(22-11-5-4-6-12-22)28-29(34-30)35(21-31-28)25-13-8-10-20-39-25/h15-18,21-22,25H,2-14,19-20H2,1H3,(H,32,33,34) |
| InChIKey | FFZFVTPDAXKOCB-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|