C28H38N8O3 — CID 118515627
2-[4-[4-[[6-(cyclohexylamino)-9-(oxan-2-yl)purin-2-yl]amino]phenyl]piperazin-1-yl]acetic acid (PubChem CID 118515627) has the molecular formula C28H38N8O3 and a molecular weight of 534.67 g/mol. Its IUPAC name is 2-[4-[4-[[6-(cyclohexylamino)-9-(oxan-2-yl)purin-2-yl]amino]phenyl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[4-[[6-(cyclohexylamino)-9-(oxan-2-yl)purin-2-yl]amino]phenyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 118515627 |
| Molecular Formula | C28H38N8O3 |
| Molecular Weight | 534.67 g/mol |
| Exact Mass | 534.31 |
| IUPAC Name | 2-[4-[4-[[6-(cyclohexylamino)-9-(oxan-2-yl)purin-2-yl]amino]phenyl]piperazin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(c2ccc(Nc3nc(NC4CCCCC4)c4ncn(C5CCCCO5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C28H38N8O3/c37-24(38)18-34-13-15-35(16-14-34)22-11-9-21(10-12-22)31-28-32-26(30-20-6-2-1-3-7-20)25-27(33-28)36(19-29-25)23-8-4-5-17-39-23/h9-12,19-20,23H,1-8,13-18H2,(H,37,38)(H2,30,31,32,33) |
| InChIKey | QHWDEVNYKJWGIA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 120.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.67 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|