C20H23N5O3 — CID 68753239
4-[[4-(cyclopropylamino)furo[3,2-d]pyrimidin-2-yl]amino]-N-(3-methoxypropyl)benzamide (PubChem CID 68753239) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is 4-[[4-(cyclopropylamino)furo[3,2-d]pyrimidin-2-yl]amino]-N-(3-methoxypropyl)benzamide.
| Compound Name | 4-[[4-(cyclopropylamino)furo[3,2-d]pyrimidin-2-yl]amino]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 68753239 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 4-[[4-(cyclopropylamino)furo[3,2-d]pyrimidin-2-yl]amino]-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCNC(=O)c1ccc(Nc2nc(NC3CC3)c3occc3n2)cc1 |
| InChI | InChI=1S/C20H23N5O3/c1-27-11-2-10-21-19(26)13-3-5-15(6-4-13)23-20-24-16-9-12-28-17(16)18(25-20)22-14-7-8-14/h3-6,9,12,14H,2,7-8,10-11H2,1H3,(H,21,26)(H2,22,23,24,25) |
| InChIKey | ZPEYHVSGRKTRRX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|