C23H30N8 — CID 162719980
4-(1-cyclohexyltriazol-4-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine (PubChem CID 162719980) has the molecular formula C23H30N8 and a molecular weight of 418.55 g/mol. Its IUPAC name is 4-(1-cyclohexyltriazol-4-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine.
| Compound Name | 4-(1-cyclohexyltriazol-4-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 162719980 |
| Molecular Formula | C23H30N8 |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | 4-(1-cyclohexyltriazol-4-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3nccc(-c4cn(C5CCCCC5)nn4)n3)cc2)CC1 |
| InChI | InChI=1S/C23H30N8/c1-29-13-15-30(16-14-29)19-9-7-18(8-10-19)25-23-24-12-11-21(26-23)22-17-31(28-27-22)20-5-3-2-4-6-20/h7-12,17,20H,2-6,13-16H2,1H3,(H,24,25,26) |
| InChIKey | HWAGPGXUHTYTOL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|