C18H21N5O2 — CID 162660458
8-cyclopentyl-2-(4-methoxyanilino)-5,7-dihydropteridin-6-one (PubChem CID 162660458) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is 8-cyclopentyl-2-(4-methoxyanilino)-5,7-dihydropteridin-6-one.
| Compound Name | 8-cyclopentyl-2-(4-methoxyanilino)-5,7-dihydropteridin-6-one |
|---|---|
| PubChem CID | 162660458 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 8-cyclopentyl-2-(4-methoxyanilino)-5,7-dihydropteridin-6-one |
| SMILES | COc1ccc(Nc2ncc3c(n2)N(C2CCCC2)CC(=O)N3)cc1 |
| InChI | InChI=1S/C18H21N5O2/c1-25-14-8-6-12(7-9-14)20-18-19-10-15-17(22-18)23(11-16(24)21-15)13-4-2-3-5-13/h6-10,13H,2-5,11H2,1H3,(H,21,24)(H,19,20,22) |
| InChIKey | VZELCCKLLAMBMG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |