C25H34F4N6 — CID 68665943
2-N-[4-(4,4-difluoropiperidin-1-yl)-3-fluorophenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine (PubChem CID 68665943) has the molecular formula C25H34F4N6 and a molecular weight of 494.58 g/mol. Its IUPAC name is 2-N-[4-(4,4-difluoropiperidin-1-yl)-3-fluorophenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[4-(4,4-difluoropiperidin-1-yl)-3-fluorophenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68665943 |
| Molecular Formula | C25H34F4N6 |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | 2-N-[4-(4,4-difluoropiperidin-1-yl)-3-fluorophenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
| SMILES | CN1C(C)(C)CC(Nc2nc(Nc3ccc(N4CCC(F)(F)CC4)c(F)c3)ncc2F)CC1(C)C |
| InChI | InChI=1S/C25H34F4N6/c1-23(2)13-17(14-24(3,4)34(23)5)31-21-19(27)15-30-22(33-21)32-16-6-7-20(18(26)12-16)35-10-8-25(28,29)9-11-35/h6-7,12,15,17H,8-11,13-14H2,1-5H3,(H2,30,31,32,33) |
| InChIKey | XFDOFTUQYWZTLZ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|