C26H38F2N6O3S — CID 68668794
5-fluoro-2-N-[3-fluoro-4-(1-methylsulfonylpiperidin-4-yl)oxyphenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine (PubChem CID 68668794) has the molecular formula C26H38F2N6O3S and a molecular weight of 552.69 g/mol. Its IUPAC name is 5-fluoro-2-N-[3-fluoro-4-(1-methylsulfonylpiperidin-4-yl)oxyphenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-2-N-[3-fluoro-4-(1-methylsulfonylpiperidin-4-yl)oxyphenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68668794 |
| Molecular Formula | C26H38F2N6O3S |
| Molecular Weight | 552.69 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | 5-fluoro-2-N-[3-fluoro-4-(1-methylsulfonylpiperidin-4-yl)oxyphenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
| SMILES | CN1C(C)(C)CC(Nc2nc(Nc3ccc(OC4CCN(S(C)(=O)=O)CC4)c(F)c3)ncc2F)CC1(C)C |
| InChI | InChI=1S/C26H38F2N6O3S/c1-25(2)14-18(15-26(3,4)33(25)5)30-23-21(28)16-29-24(32-23)31-17-7-8-22(20(27)13-17)37-19-9-11-34(12-10-19)38(6,35)36/h7-8,13,16,18-19H,9-12,14-15H2,1-6H3,(H2,29,30,31,32) |
| InChIKey | HFDFUMOUGPYHSR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.69 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |