C21H26ClF4N5O — CID 68665935
2-N-[3-chloro-4-(trifluoromethoxy)phenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine (PubChem CID 68665935) has the molecular formula C21H26ClF4N5O and a molecular weight of 475.92 g/mol. Its IUPAC name is 2-N-[3-chloro-4-(trifluoromethoxy)phenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[3-chloro-4-(trifluoromethoxy)phenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68665935 |
| Molecular Formula | C21H26ClF4N5O |
| Molecular Weight | 475.92 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 2-N-[3-chloro-4-(trifluoromethoxy)phenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
| SMILES | CN1C(C)(C)CC(Nc2nc(Nc3ccc(OC(F)(F)F)c(Cl)c3)ncc2F)CC1(C)C |
| InChI | InChI=1S/C21H26ClF4N5O/c1-19(2)9-13(10-20(3,4)31(19)5)28-17-15(23)11-27-18(30-17)29-12-6-7-16(14(22)8-12)32-21(24,25)26/h6-8,11,13H,9-10H2,1-5H3,(H2,27,28,29,30) |
| InChIKey | DUWVWTLLVACMBZ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.92 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |