C25H29F4N5O — CID 68665778
5-fluoro-2-N-[4-(furan-3-yl)-3-(trifluoromethyl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine (PubChem CID 68665778) has the molecular formula C25H29F4N5O and a molecular weight of 491.53 g/mol. Its IUPAC name is 5-fluoro-2-N-[4-(furan-3-yl)-3-(trifluoromethyl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-2-N-[4-(furan-3-yl)-3-(trifluoromethyl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68665778 |
| Molecular Formula | C25H29F4N5O |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | 5-fluoro-2-N-[4-(furan-3-yl)-3-(trifluoromethyl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
| SMILES | CN1C(C)(C)CC(Nc2nc(Nc3ccc(-c4ccoc4)c(C(F)(F)F)c3)ncc2F)CC1(C)C |
| InChI | InChI=1S/C25H29F4N5O/c1-23(2)11-17(12-24(3,4)34(23)5)31-21-20(26)13-30-22(33-21)32-16-6-7-18(15-8-9-35-14-15)19(10-16)25(27,28)29/h6-10,13-14,17H,11-12H2,1-5H3,(H2,30,31,32,33) |
| InChIKey | DXPLLZJBWRUZKA-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 66.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |