C29H31F4N5OS — CID 68664952
2-N-[3-(1-benzothiophen-2-yl)-4-(trifluoromethoxy)phenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine (PubChem CID 68664952) has the molecular formula C29H31F4N5OS and a molecular weight of 573.66 g/mol. Its IUPAC name is 2-N-[3-(1-benzothiophen-2-yl)-4-(trifluoromethoxy)phenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[3-(1-benzothiophen-2-yl)-4-(trifluoromethoxy)phenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68664952 |
| Molecular Formula | C29H31F4N5OS |
| Molecular Weight | 573.66 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | 2-N-[3-(1-benzothiophen-2-yl)-4-(trifluoromethoxy)phenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
| SMILES | CN1C(C)(C)CC(Nc2nc(Nc3ccc(OC(F)(F)F)c(-c4cc5ccccc5s4)c3)ncc2F)CC1(C)C |
| InChI | InChI=1S/C29H31F4N5OS/c1-27(2)14-19(15-28(3,4)38(27)5)35-25-21(30)16-34-26(37-25)36-18-10-11-22(39-29(31,32)33)20(13-18)24-12-17-8-6-7-9-23(17)40-24/h6-13,16,19H,14-15H2,1-5H3,(H2,34,35,36,37) |
| InChIKey | BZIIRPXPAOALBT-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.66 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |