C22H27F6N5O — CID 87285927
2-N-[3-(difluoromethoxy)-5-(trifluoromethyl)phenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine (PubChem CID 87285927) has the molecular formula C22H27F6N5O and a molecular weight of 491.48 g/mol. Its IUPAC name is 2-N-[3-(difluoromethoxy)-5-(trifluoromethyl)phenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[3-(difluoromethoxy)-5-(trifluoromethyl)phenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 87285927 |
| Molecular Formula | C22H27F6N5O |
| Molecular Weight | 491.48 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 2-N-[3-(difluoromethoxy)-5-(trifluoromethyl)phenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
| SMILES | CN1C(C)(C)CC(Nc2nc(Nc3cc(OC(F)F)cc(C(F)(F)F)c3)ncc2F)CC1(C)C |
| InChI | InChI=1S/C22H27F6N5O/c1-20(2)9-14(10-21(3,4)33(20)5)30-17-16(23)11-29-19(32-17)31-13-6-12(22(26,27)28)7-15(8-13)34-18(24)25/h6-8,11,14,18H,9-10H2,1-5H3,(H2,29,30,31,32) |
| InChIKey | GLJCSAKMZLXXIC-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.48 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |