C25H32F6N6O3 — CID 87535151
2-[3,5-bis(2,2,2-trifluoroethoxy)anilino]-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyrimidine-5-carboxamide (PubChem CID 87535151) has the molecular formula C25H32F6N6O3 and a molecular weight of 578.56 g/mol. Its IUPAC name is 2-[3,5-bis(2,2,2-trifluoroethoxy)anilino]-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyrimidine-5-carboxamide.
| Compound Name | 2-[3,5-bis(2,2,2-trifluoroethoxy)anilino]-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 87535151 |
| Molecular Formula | C25H32F6N6O3 |
| Molecular Weight | 578.56 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | 2-[3,5-bis(2,2,2-trifluoroethoxy)anilino]-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyrimidine-5-carboxamide |
| SMILES | CN1C(C)(C)CC(Nc2nc(Nc3cc(OCC(F)(F)F)cc(OCC(F)(F)F)c3)ncc2C(N)=O)CC1(C)C |
| InChI | InChI=1S/C25H32F6N6O3/c1-22(2)9-15(10-23(3,4)37(22)5)34-20-18(19(32)38)11-33-21(36-20)35-14-6-16(39-12-24(26,27)28)8-17(7-14)40-13-25(29,30)31/h6-8,11,15H,9-10,12-13H2,1-5H3,(H2,32,38)(H2,33,34,35,36) |
| InChIKey | GMMSHEAZERHQCQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.56 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |