C24H32FN5O4 — CID 68665827
(E)-3-[4-[[2-(3,5-dimethoxyanilino)-5-fluoropyrimidin-4-yl]amino]-2,2,6,6-tetramethylpiperidin-1-yl]prop-2-enoic acid (PubChem CID 68665827) has the molecular formula C24H32FN5O4 and a molecular weight of 473.55 g/mol. Its IUPAC name is (E)-3-[4-[[2-(3,5-dimethoxyanilino)-5-fluoropyrimidin-4-yl]amino]-2,2,6,6-tetramethylpiperidin-1-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[2-(3,5-dimethoxyanilino)-5-fluoropyrimidin-4-yl]amino]-2,2,6,6-tetramethylpiperidin-1-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68665827 |
| Molecular Formula | C24H32FN5O4 |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | (E)-3-[4-[[2-(3,5-dimethoxyanilino)-5-fluoropyrimidin-4-yl]amino]-2,2,6,6-tetramethylpiperidin-1-yl]prop-2-enoic acid |
| SMILES | COc1cc(Nc2ncc(F)c(NC3CC(C)(C)N(/C=C/C(=O)O)C(C)(C)C3)n2)cc(OC)c1 |
| InChI | InChI=1S/C24H32FN5O4/c1-23(2)12-16(13-24(3,4)30(23)8-7-20(31)32)27-21-19(25)14-26-22(29-21)28-15-9-17(33-5)11-18(10-15)34-6/h7-11,14,16H,12-13H2,1-6H3,(H,31,32)(H2,26,27,28,29)/b8-7+ |
| InChIKey | AQVRTXLAEGSNIY-BQYQJAHWSA-N |
| XLogP | 4.41 |
| TPSA | 108.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|