C26H40FN5O4 — CID 68664714
2-N-[3,5-bis(2-methoxyethoxy)phenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine (PubChem CID 68664714) has the molecular formula C26H40FN5O4 and a molecular weight of 505.64 g/mol. Its IUPAC name is 2-N-[3,5-bis(2-methoxyethoxy)phenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[3,5-bis(2-methoxyethoxy)phenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68664714 |
| Molecular Formula | C26H40FN5O4 |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.31 |
| IUPAC Name | 2-N-[3,5-bis(2-methoxyethoxy)phenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
| SMILES | COCCOc1cc(Nc2ncc(F)c(NC3CC(C)(C)N(C)C(C)(C)C3)n2)cc(OCCOC)c1 |
| InChI | InChI=1S/C26H40FN5O4/c1-25(2)15-19(16-26(3,4)32(25)5)29-23-22(27)17-28-24(31-23)30-18-12-20(35-10-8-33-6)14-21(13-18)36-11-9-34-7/h12-14,17,19H,8-11,15-16H2,1-7H3,(H2,28,29,30,31) |
| InChIKey | UCBLCDTWPSGBQJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 90.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|