C24H30FN5O — CID 68664885
5-fluoro-2-N-[4-(furan-3-yl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine (PubChem CID 68664885) has the molecular formula C24H30FN5O and a molecular weight of 423.54 g/mol. Its IUPAC name is 5-fluoro-2-N-[4-(furan-3-yl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-2-N-[4-(furan-3-yl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68664885 |
| Molecular Formula | C24H30FN5O |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 5-fluoro-2-N-[4-(furan-3-yl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
| SMILES | CN1C(C)(C)CC(Nc2nc(Nc3ccc(-c4ccoc4)cc3)ncc2F)CC1(C)C |
| InChI | InChI=1S/C24H30FN5O/c1-23(2)12-19(13-24(3,4)30(23)5)27-21-20(25)14-26-22(29-21)28-18-8-6-16(7-9-18)17-10-11-31-15-17/h6-11,14-15,19H,12-13H2,1-5H3,(H2,26,27,28,29) |
| InChIKey | PYZYOHBGBMNOJL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 66.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |