C34H45F3N6O2 — CID 68668905
2-N-[3,5-difluoro-4-[1-(2-phenylmethoxyethyl)piperidin-4-yl]oxyphenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine (PubChem CID 68668905) has the molecular formula C34H45F3N6O2 and a molecular weight of 626.77 g/mol. Its IUPAC name is 2-N-[3,5-difluoro-4-[1-(2-phenylmethoxyethyl)piperidin-4-yl]oxyphenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[3,5-difluoro-4-[1-(2-phenylmethoxyethyl)piperidin-4-yl]oxyphenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68668905 |
| Molecular Formula | C34H45F3N6O2 |
| Molecular Weight | 626.77 g/mol |
| Exact Mass | 626.36 |
| IUPAC Name | 2-N-[3,5-difluoro-4-[1-(2-phenylmethoxyethyl)piperidin-4-yl]oxyphenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
| SMILES | CN1C(C)(C)CC(Nc2nc(Nc3cc(F)c(OC4CCN(CCOCc5ccccc5)CC4)c(F)c3)ncc2F)CC1(C)C |
| InChI | InChI=1S/C34H45F3N6O2/c1-33(2)19-25(20-34(3,4)42(33)5)39-31-29(37)21-38-32(41-31)40-24-17-27(35)30(28(36)18-24)45-26-11-13-43(14-12-26)15-16-44-22-23-9-7-6-8-10-23/h6-10,17-18,21,25-26H,11-16,19-20,22H2,1-5H3,(H2,38,39,40,41) |
| InChIKey | FBRPENHXGMIIFY-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.77 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|