C33H43F4N7O4S — CID 68665575
benzoic acid;5-fluoro-2-N-[4-(4-methylsulfonylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine (PubChem CID 68665575) has the molecular formula C33H43F4N7O4S and a molecular weight of 709.81 g/mol. Its IUPAC name is benzoic acid;5-fluoro-2-N-[4-(4-methylsulfonylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine.
| Compound Name | benzoic acid;5-fluoro-2-N-[4-(4-methylsulfonylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68665575 |
| Molecular Formula | C33H43F4N7O4S |
| Molecular Weight | 709.81 g/mol |
| Exact Mass | 709.30 |
| IUPAC Name | benzoic acid;5-fluoro-2-N-[4-(4-methylsulfonylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
| SMILES | CN1C(C)(C)CC(Nc2nc(Nc3ccc(N4CCN(S(C)(=O)=O)CC4)c(C(F)(F)F)c3)ncc2F)CC1(C)C.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C26H37F4N7O2S.C7H6O2/c1-24(2)14-18(15-25(3,4)35(24)5)32-22-20(27)16-31-23(34-22)33-17-7-8-21(19(13-17)26(28,29)30)36-9-11-37(12-10-36)40(6,38)39;8-7(9)6-4-2-1-3-5-6/h7-8,13,16,18H,9-12,14-15H2,1-6H3,(H2,31,32,33,34);1-5H,(H,8,9) |
| InChIKey | ROJHQACCWMYGJL-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.81 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|