C26H37F3N8O4S — CID 46844128
2-N-[4-(4-methylsulfonylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]-5-nitro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine (PubChem CID 46844128) has the molecular formula C26H37F3N8O4S and a molecular weight of 614.70 g/mol. Its IUPAC name is 2-N-[4-(4-methylsulfonylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]-5-nitro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[4-(4-methylsulfonylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]-5-nitro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 46844128 |
| Molecular Formula | C26H37F3N8O4S |
| Molecular Weight | 614.70 g/mol |
| Exact Mass | 614.26 |
| IUPAC Name | 2-N-[4-(4-methylsulfonylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]-5-nitro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
| SMILES | CN1C(C)(C)CC(Nc2nc(Nc3ccc(N4CCN(S(C)(=O)=O)CC4)c(C(F)(F)F)c3)ncc2[N+](=O)[O-])CC1(C)C |
| InChI | InChI=1S/C26H37F3N8O4S/c1-24(2)14-18(15-25(3,4)34(24)5)31-22-21(37(38)39)16-30-23(33-22)32-17-7-8-20(19(13-17)26(27,28)29)35-9-11-36(12-10-35)42(6,40)41/h7-8,13,16,18H,9-12,14-15H2,1-6H3,(H2,30,31,32,33) |
| InChIKey | DXZVDPQAMLWVRX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 136.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.70 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|