C14H13FN6O4 — CID 90358627
3-[[2-(4-fluoroanilino)-5-nitropyrimidin-4-yl]amino]azetidine-1-carboxylic acid (PubChem CID 90358627) has the molecular formula C14H13FN6O4 and a molecular weight of 348.29 g/mol. Its IUPAC name is 3-[[2-(4-fluoroanilino)-5-nitropyrimidin-4-yl]amino]azetidine-1-carboxylic acid.
| Compound Name | 3-[[2-(4-fluoroanilino)-5-nitropyrimidin-4-yl]amino]azetidine-1-carboxylic acid |
|---|---|
| PubChem CID | 90358627 |
| Molecular Formula | C14H13FN6O4 |
| Molecular Weight | 348.29 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 3-[[2-(4-fluoroanilino)-5-nitropyrimidin-4-yl]amino]azetidine-1-carboxylic acid |
| SMILES | O=C(O)N1CC(Nc2nc(Nc3ccc(F)cc3)ncc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C14H13FN6O4/c15-8-1-3-9(4-2-8)18-13-16-5-11(21(24)25)12(19-13)17-10-6-20(7-10)14(22)23/h1-5,10H,6-7H2,(H,22,23)(H2,16,17,18,19) |
| InChIKey | FBWNYMYFVDEEGW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|