C17H13FN6O4 — CID 90358710
[3-[[2-(4-fluoroanilino)-5-nitropyrimidin-4-yl]amino]phenyl]carbamic acid (PubChem CID 90358710) has the molecular formula C17H13FN6O4 and a molecular weight of 384.33 g/mol. Its IUPAC name is [3-[[2-(4-fluoroanilino)-5-nitropyrimidin-4-yl]amino]phenyl]carbamic acid.
| Compound Name | [3-[[2-(4-fluoroanilino)-5-nitropyrimidin-4-yl]amino]phenyl]carbamic acid |
|---|---|
| PubChem CID | 90358710 |
| Molecular Formula | C17H13FN6O4 |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | [3-[[2-(4-fluoroanilino)-5-nitropyrimidin-4-yl]amino]phenyl]carbamic acid |
| SMILES | O=C(O)Nc1cccc(Nc2nc(Nc3ccc(F)cc3)ncc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H13FN6O4/c18-10-4-6-11(7-5-10)21-16-19-9-14(24(27)28)15(23-16)20-12-2-1-3-13(8-12)22-17(25)26/h1-9,22H,(H,25,26)(H2,19,20,21,23) |
| InChIKey | YNHKZGWPJGHCHQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 142.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|