C11H8ClN5O4 — CID 174840132
[4-[(2-chloro-5-nitropyrimidin-4-yl)amino]phenyl]carbamic acid (PubChem CID 174840132) has the molecular formula C11H8ClN5O4 and a molecular weight of 309.67 g/mol. Its IUPAC name is [4-[(2-chloro-5-nitropyrimidin-4-yl)amino]phenyl]carbamic acid.
| Compound Name | [4-[(2-chloro-5-nitropyrimidin-4-yl)amino]phenyl]carbamic acid |
|---|---|
| PubChem CID | 174840132 |
| Molecular Formula | C11H8ClN5O4 |
| Molecular Weight | 309.67 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | [4-[(2-chloro-5-nitropyrimidin-4-yl)amino]phenyl]carbamic acid |
| SMILES | O=C(O)Nc1ccc(Nc2nc(Cl)ncc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H8ClN5O4/c12-10-13-5-8(17(20)21)9(16-10)14-6-1-3-7(4-2-6)15-11(18)19/h1-5,15H,(H,18,19)(H,13,14,16) |
| InChIKey | UHMGKBAJDDHGFD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 130.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.67 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|