C21H16ClN5O5 — CID 121400792
2-[3-[4-[(2-chloro-5-nitropyrimidin-4-yl)amino]phenoxy]propyl]isoindole-1,3-dione (PubChem CID 121400792) has the molecular formula C21H16ClN5O5 and a molecular weight of 453.84 g/mol. Its IUPAC name is 2-[3-[4-[(2-chloro-5-nitropyrimidin-4-yl)amino]phenoxy]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[4-[(2-chloro-5-nitropyrimidin-4-yl)amino]phenoxy]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 121400792 |
| Molecular Formula | C21H16ClN5O5 |
| Molecular Weight | 453.84 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 2-[3-[4-[(2-chloro-5-nitropyrimidin-4-yl)amino]phenoxy]propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCOc1ccc(Nc2nc(Cl)ncc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H16ClN5O5/c22-21-23-12-17(27(30)31)18(25-21)24-13-6-8-14(9-7-13)32-11-3-10-26-19(28)15-4-1-2-5-16(15)20(26)29/h1-2,4-9,12H,3,10-11H2,(H,23,24,25) |
| InChIKey | WZCZYPBDWFFWHV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 127.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.84 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|