C24H22Cl2N8O8 — CID 157386762
2-N,4-N-bis(3,4-dimethoxyphenyl)-5-nitropyrimidine-2,4-diamine;2,4-dichloro-5-nitropyrimidine (PubChem CID 157386762) has the molecular formula C24H22Cl2N8O8 and a molecular weight of 621.39 g/mol. Its IUPAC name is 2-N,4-N-bis(3,4-dimethoxyphenyl)-5-nitropyrimidine-2,4-diamine;2,4-dichloro-5-nitropyrimidine.
| Compound Name | 2-N,4-N-bis(3,4-dimethoxyphenyl)-5-nitropyrimidine-2,4-diamine;2,4-dichloro-5-nitropyrimidine |
|---|---|
| PubChem CID | 157386762 |
| Molecular Formula | C24H22Cl2N8O8 |
| Molecular Weight | 621.39 g/mol |
| Exact Mass | 620.09 |
| IUPAC Name | 2-N,4-N-bis(3,4-dimethoxyphenyl)-5-nitropyrimidine-2,4-diamine;2,4-dichloro-5-nitropyrimidine |
| SMILES | COc1ccc(Nc2ncc([N+](=O)[O-])c(Nc3ccc(OC)c(OC)c3)n2)cc1OC.O=[N+]([O-])c1cnc(Cl)nc1Cl |
| InChI | InChI=1S/C20H21N5O6.C4HCl2N3O2/c1-28-15-7-5-12(9-17(15)30-3)22-19-14(25(26)27)11-21-20(24-19)23-13-6-8-16(29-2)18(10-13)31-4;5-3-2(9(10)11)1-7-4(6)8-3/h5-11H,1-4H3,(H2,21,22,23,24);1H |
| InChIKey | BLNIVLUDFBHASN-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 198.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.39 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|