C21H22N6O5 — CID 71017281
4-N-(2,3-dihydro-1H-indol-4-yl)-5-nitro-2-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine (PubChem CID 71017281) has the molecular formula C21H22N6O5 and a molecular weight of 438.44 g/mol. Its IUPAC name is 4-N-(2,3-dihydro-1H-indol-4-yl)-5-nitro-2-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(2,3-dihydro-1H-indol-4-yl)-5-nitro-2-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 71017281 |
| Molecular Formula | C21H22N6O5 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 4-N-(2,3-dihydro-1H-indol-4-yl)-5-nitro-2-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine |
| SMILES | COc1cc(Nc2ncc([N+](=O)[O-])c(Nc3cccc4c3CCN4)n2)cc(OC)c1OC |
| InChI | InChI=1S/C21H22N6O5/c1-30-17-9-12(10-18(31-2)19(17)32-3)24-21-23-11-16(27(28)29)20(26-21)25-15-6-4-5-14-13(15)7-8-22-14/h4-6,9-11,22H,7-8H2,1-3H3,(H2,23,24,25,26) |
| InChIKey | CGRISFPXOCRZHR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 132.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|