C13H11N5O2 — CID 21077481
2-N-(3-ethynylphenyl)-4-N-methyl-5-nitropyrimidine-2,4-diamine (PubChem CID 21077481) has the molecular formula C13H11N5O2 and a molecular weight of 269.26 g/mol. Its IUPAC name is 2-N-(3-ethynylphenyl)-4-N-methyl-5-nitropyrimidine-2,4-diamine.
| Compound Name | 2-N-(3-ethynylphenyl)-4-N-methyl-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 21077481 |
| Molecular Formula | C13H11N5O2 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 2-N-(3-ethynylphenyl)-4-N-methyl-5-nitropyrimidine-2,4-diamine |
| SMILES | C#Cc1cccc(Nc2ncc([N+](=O)[O-])c(NC)n2)c1 |
| InChI | InChI=1S/C13H11N5O2/c1-3-9-5-4-6-10(7-9)16-13-15-8-11(18(19)20)12(14-2)17-13/h1,4-8H,2H3,(H2,14,15,16,17) |
| InChIKey | NUWUVTZHYGWSOF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|