C16H24N6O5 — CID 135342259
4-[[2-[(4-methyloxan-4-yl)amino]-5-nitropyrimidin-4-yl]amino]piperidine-1-carboxylic acid (PubChem CID 135342259) has the molecular formula C16H24N6O5 and a molecular weight of 380.41 g/mol. Its IUPAC name is 4-[[2-[(4-methyloxan-4-yl)amino]-5-nitropyrimidin-4-yl]amino]piperidine-1-carboxylic acid.
| Compound Name | 4-[[2-[(4-methyloxan-4-yl)amino]-5-nitropyrimidin-4-yl]amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 135342259 |
| Molecular Formula | C16H24N6O5 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 4-[[2-[(4-methyloxan-4-yl)amino]-5-nitropyrimidin-4-yl]amino]piperidine-1-carboxylic acid |
| SMILES | CC1(Nc2ncc([N+](=O)[O-])c(NC3CCN(C(=O)O)CC3)n2)CCOCC1 |
| InChI | InChI=1S/C16H24N6O5/c1-16(4-8-27-9-5-16)20-14-17-10-12(22(25)26)13(19-14)18-11-2-6-21(7-3-11)15(23)24/h10-11H,2-9H2,1H3,(H,23,24)(H2,17,18,19,20) |
| InChIKey | GASBPQCMACBXES-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|