C17H24FN5O5 — CID 121253410
4-[[2-[[(3S,4S)-3-fluorooxan-4-yl]amino]-5-nitropyrimidin-4-yl]amino]-1-methylcyclohexane-1-carboxylic acid (PubChem CID 121253410) has the molecular formula C17H24FN5O5 and a molecular weight of 397.41 g/mol. Its IUPAC name is 4-[[2-[[(3S,4S)-3-fluorooxan-4-yl]amino]-5-nitropyrimidin-4-yl]amino]-1-methylcyclohexane-1-carboxylic acid.
| Compound Name | 4-[[2-[[(3S,4S)-3-fluorooxan-4-yl]amino]-5-nitropyrimidin-4-yl]amino]-1-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 121253410 |
| Molecular Formula | C17H24FN5O5 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 4-[[2-[[(3S,4S)-3-fluorooxan-4-yl]amino]-5-nitropyrimidin-4-yl]amino]-1-methylcyclohexane-1-carboxylic acid |
| SMILES | CC1(C(=O)O)CCC(Nc2nc(N[C@H]3CCOC[C@H]3F)ncc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H24FN5O5/c1-17(15(24)25)5-2-10(3-6-17)20-14-13(23(26)27)8-19-16(22-14)21-12-4-7-28-9-11(12)18/h8,10-12H,2-7,9H2,1H3,(H,24,25)(H2,19,20,21,22)/t10?,11-,12+,17?/m1/s1 |
| InChIKey | WUYWWAMLEDOWEI-SVUPHLTFSA-N |
| XLogP | 2.37 |
| TPSA | 139.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|